C21H21NO2 — CID 174334542
3-[(1E)-3-(5,8-dimethylnaphthalen-1-yl)buta-1,3-dienyl]piperidine-2,6-dione (PubChem CID 174334542) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-[(1E)-3-(5,8-dimethylnaphthalen-1-yl)buta-1,3-dienyl]piperidine-2,6-dione.
| Compound Name | 3-[(1E)-3-(5,8-dimethylnaphthalen-1-yl)buta-1,3-dienyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174334542 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 3-[(1E)-3-(5,8-dimethylnaphthalen-1-yl)buta-1,3-dienyl]piperidine-2,6-dione |
| SMILES | C=C(/C=C/C1CCC(=O)NC1=O)c1cccc2c(C)ccc(C)c12 |
| InChI | InChI=1S/C21H21NO2/c1-13-7-8-15(3)20-17(13)5-4-6-18(20)14(2)9-10-16-11-12-19(23)22-21(16)24/h4-10,16H,2,11-12H2,1,3H3,(H,22,23,24)/b10-9+ |
| InChIKey | BXKWJBLBJAEHOD-MDZDMXLPSA-N |
| XLogP | 4.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|