C20H21NO3 — CID 174331198
3-[(E)-3-(5,8-dimethylnaphthalen-1-yl)-3-hydroxyprop-1-enyl]piperidine-2,6-dione (PubChem CID 174331198) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-[(E)-3-(5,8-dimethylnaphthalen-1-yl)-3-hydroxyprop-1-enyl]piperidine-2,6-dione.
| Compound Name | 3-[(E)-3-(5,8-dimethylnaphthalen-1-yl)-3-hydroxyprop-1-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174331198 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3-[(E)-3-(5,8-dimethylnaphthalen-1-yl)-3-hydroxyprop-1-enyl]piperidine-2,6-dione |
| SMILES | Cc1ccc(C)c2c(C(O)/C=C/C3CCC(=O)NC3=O)cccc12 |
| InChI | InChI=1S/C20H21NO3/c1-12-6-7-13(2)19-15(12)4-3-5-16(19)17(22)10-8-14-9-11-18(23)21-20(14)24/h3-8,10,14,17,22H,9,11H2,1-2H3,(H,21,23,24)/b10-8+ |
| InChIKey | LFHQWGXXAOMIKF-CSKARUKUSA-N |
| XLogP | 3.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|