C30H31FN2O5 — CID 177335249
N-(2,6-dioxopiperidin-3-yl)-N-[4-[[2-fluoro-4-[hydroxy(oxan-4-yl)methyl]phenyl]methyl]-8-methylnaphthalen-1-yl]formamide (PubChem CID 177335249) has the molecular formula C30H31FN2O5 and a molecular weight of 518.59 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-N-[4-[[2-fluoro-4-[hydroxy(oxan-4-yl)methyl]phenyl]methyl]-8-methylnaphthalen-1-yl]formamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-N-[4-[[2-fluoro-4-[hydroxy(oxan-4-yl)methyl]phenyl]methyl]-8-methylnaphthalen-1-yl]formamide |
|---|---|
| PubChem CID | 177335249 |
| Molecular Formula | C30H31FN2O5 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-N-[4-[[2-fluoro-4-[hydroxy(oxan-4-yl)methyl]phenyl]methyl]-8-methylnaphthalen-1-yl]formamide |
| SMILES | Cc1cccc2c(Cc3ccc(C(O)C4CCOCC4)cc3F)ccc(N(C=O)C3CCC(=O)NC3=O)c12 |
| InChI | InChI=1S/C30H31FN2O5/c1-18-3-2-4-23-20(7-8-25(28(18)23)33(17-34)26-9-10-27(35)32-30(26)37)15-21-5-6-22(16-24(21)31)29(36)19-11-13-38-14-12-19/h2-8,16-17,19,26,29,36H,9-15H2,1H3,(H,32,35,37) |
| InChIKey | KSLUWFCFRLWJII-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|