C22H24N2O4S — CID 167474074
tert-butyl 4-[4-[(4-methylsulfinylphenyl)methoxy]phenyl]imidazole-1-carboxylate (PubChem CID 167474074) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is tert-butyl 4-[4-[(4-methylsulfinylphenyl)methoxy]phenyl]imidazole-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(4-methylsulfinylphenyl)methoxy]phenyl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 167474074 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | tert-butyl 4-[4-[(4-methylsulfinylphenyl)methoxy]phenyl]imidazole-1-carboxylate |
| SMILES | CS(=O)c1ccc(COc2ccc(-c3cn(C(=O)OC(C)(C)C)cn3)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-22(2,3)28-21(25)24-13-20(23-15-24)17-7-9-18(10-8-17)27-14-16-5-11-19(12-6-16)29(4)26/h5-13,15H,14H2,1-4H3 |
| InChIKey | CYHBCPRRMWTRRZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |