C21H28N4O4S — CID 51030809
tert-butyl 4-[5-[(4-methylsulfinylphenyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 51030809) has the molecular formula C21H28N4O4S and a molecular weight of 432.55 g/mol. Its IUPAC name is tert-butyl 4-[5-[(4-methylsulfinylphenyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(4-methylsulfinylphenyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 51030809 |
| Molecular Formula | C21H28N4O4S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | tert-butyl 4-[5-[(4-methylsulfinylphenyl)methoxy]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CS(=O)c1ccc(COc2cnc(N3CCN(C(=O)OC(C)(C)C)CC3)nc2)cc1 |
| InChI | InChI=1S/C21H28N4O4S/c1-21(2,3)29-20(26)25-11-9-24(10-12-25)19-22-13-17(14-23-19)28-15-16-5-7-18(8-6-16)30(4)27/h5-8,13-14H,9-12,15H2,1-4H3 |
| InChIKey | GLOOSBFLEDUJDI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |