C21H27FN4O3 — CID 156754926
tert-butyl 4-[5-[2-(3-fluorophenyl)ethoxy]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 156754926) has the molecular formula C21H27FN4O3 and a molecular weight of 402.47 g/mol. Its IUPAC name is tert-butyl 4-[5-[2-(3-fluorophenyl)ethoxy]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[2-(3-fluorophenyl)ethoxy]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156754926 |
| Molecular Formula | C21H27FN4O3 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | tert-butyl 4-[5-[2-(3-fluorophenyl)ethoxy]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncc(OCCc3cccc(F)c3)cn2)CC1 |
| InChI | InChI=1S/C21H27FN4O3/c1-21(2,3)29-20(27)26-10-8-25(9-11-26)19-23-14-18(15-24-19)28-12-7-16-5-4-6-17(22)13-16/h4-6,13-15H,7-12H2,1-3H3 |
| InChIKey | OWESGMNVBAWNQH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |