C24H40O3 — CID 16747740
ethyl 3-(2-hydroxy-10-methyl-2,3,4,5,6,7,8,9,10,11-decahydro-1H-cyclopenta[10]annulen-5-yl)-5-methylcyclohexane-1-carboxylate (PubChem CID 16747740) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is ethyl 3-(2-hydroxy-10-methyl-2,3,4,5,6,7,8,9,10,11-decahydro-1H-cyclopenta[10]annulen-5-yl)-5-methylcyclohexane-1-carboxylate.
| Compound Name | ethyl 3-(2-hydroxy-10-methyl-2,3,4,5,6,7,8,9,10,11-decahydro-1H-cyclopenta[10]annulen-5-yl)-5-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 16747740 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | ethyl 3-(2-hydroxy-10-methyl-2,3,4,5,6,7,8,9,10,11-decahydro-1H-cyclopenta[10]annulen-5-yl)-5-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(C)CC(C2CCCCC(C)CC3=C(CC(O)C3)C2)C1 |
| InChI | InChI=1S/C24H40O3/c1-4-27-24(26)22-11-17(3)10-19(13-22)18-8-6-5-7-16(2)9-20-14-23(25)15-21(20)12-18/h16-19,22-23,25H,4-15H2,1-3H3 |
| InChIKey | YZUHSJMLSJWKHV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|