C31H36N2O2 — CID 167485714
(5E)-5-[(2E)-2-(5-amino-1-hexyl-3,3-dimethylindol-2-ylidene)ethylidene]-7,8-dihydro-6H-xanthen-3-one (PubChem CID 167485714) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is (5E)-5-[(2E)-2-(5-amino-1-hexyl-3,3-dimethylindol-2-ylidene)ethylidene]-7,8-dihydro-6H-xanthen-3-one.
| Compound Name | (5E)-5-[(2E)-2-(5-amino-1-hexyl-3,3-dimethylindol-2-ylidene)ethylidene]-7,8-dihydro-6H-xanthen-3-one |
|---|---|
| PubChem CID | 167485714 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | (5E)-5-[(2E)-2-(5-amino-1-hexyl-3,3-dimethylindol-2-ylidene)ethylidene]-7,8-dihydro-6H-xanthen-3-one |
| SMILES | CCCCCCN1/C(=C/C=C2\CCCc3cc4ccc(=O)cc-4oc32)C(C)(C)c2cc(N)ccc21 |
| InChI | InChI=1S/C31H36N2O2/c1-4-5-6-7-17-33-27-15-13-24(32)19-26(27)31(2,3)29(33)16-12-21-9-8-10-23-18-22-11-14-25(34)20-28(22)35-30(21)23/h11-16,18-20H,4-10,17,32H2,1-3H3/b21-12+,29-16+ |
| InChIKey | CCAQYKNCHPRUKL-PQWBQQMPSA-N |
| XLogP | 7.31 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|