C36H45N2O6S+ — CID 135537027
[(6E)-6-[(2E)-2-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]ethylidene]-7,8,9,10-tetrahydrocyclohepta[b]chromen-3-ylidene]-diethylazanium (PubChem CID 135537027) has the molecular formula C36H45N2O6S+ and a molecular weight of 633.83 g/mol. Its IUPAC name is [(6E)-6-[(2E)-2-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]ethylidene]-7,8,9,10-tetrahydrocyclohepta[b]chromen-3-ylidene]-diethylazanium.
| Compound Name | [(6E)-6-[(2E)-2-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]ethylidene]-7,8,9,10-tetrahydrocyclohepta[b]chromen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 135537027 |
| Molecular Formula | C36H45N2O6S+ |
| Molecular Weight | 633.83 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | [(6E)-6-[(2E)-2-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]ethylidene]-7,8,9,10-tetrahydrocyclohepta[b]chromen-3-ylidene]-diethylazanium |
| SMILES | CC[N+](CC)=c1ccc2cc3c(oc-2c1)/C(=C/C=C1/N(CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)C)CCCC3 |
| InChI | InChI=1S/C36H44N2O6S/c1-5-37(6-2)28-17-15-26-22-27-13-10-9-12-25(35(27)44-32(26)23-28)16-20-33-36(3,4)30-24-29(45(41,42)43)18-19-31(30)38(33)21-11-7-8-14-34(39)40/h15-20,22-24H,5-14,21H2,1-4H3,(H-,39,40,41,42,43)/p+1 |
| InChIKey | VECYIASMFQSXIK-UHFFFAOYSA-O |
| XLogP | 6.88 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.83 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|