C21H25F3N2O4 — CID 167488462
1-O-tert-butyl 3-O-ethyl 3-[2-[6-(trifluoromethyl)-2-pyridinyl]ethynyl]piperidine-1,3-dicarboxylate (PubChem CID 167488462) has the molecular formula C21H25F3N2O4 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 3-[2-[6-(trifluoromethyl)-2-pyridinyl]ethynyl]piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 3-[2-[6-(trifluoromethyl)-2-pyridinyl]ethynyl]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 167488462 |
| Molecular Formula | C21H25F3N2O4 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 3-[2-[6-(trifluoromethyl)-2-pyridinyl]ethynyl]piperidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C#Cc2cccc(C(F)(F)F)n2)CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H25F3N2O4/c1-5-29-17(27)20(11-7-13-26(14-20)18(28)30-19(2,3)4)12-10-15-8-6-9-16(25-15)21(22,23)24/h6,8-9H,5,7,11,13-14H2,1-4H3 |
| InChIKey | KABOKTYPVXTGCL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|