C16H20F3N3O4 — CID 167490871
(1S,2R,3R,4R,5S)-5-cyclopentyl-4-[[5-(trifluoromethyl)pyrazin-2-yl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 167490871) has the molecular formula C16H20F3N3O4 and a molecular weight of 375.35 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-5-cyclopentyl-4-[[5-(trifluoromethyl)pyrazin-2-yl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4R,5S)-5-cyclopentyl-4-[[5-(trifluoromethyl)pyrazin-2-yl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 167490871 |
| Molecular Formula | C16H20F3N3O4 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (1S,2R,3R,4R,5S)-5-cyclopentyl-4-[[5-(trifluoromethyl)pyrazin-2-yl]amino]-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](Nc2cnc(C(F)(F)F)cn2)[C@@]2(C3CCCC3)OC[C@@H]1O2 |
| InChI | InChI=1S/C16H20F3N3O4/c17-16(18,19)10-5-21-11(6-20-10)22-14-13(24)12(23)9-7-25-15(14,26-9)8-3-1-2-4-8/h5-6,8-9,12-14,23-24H,1-4,7H2,(H,21,22)/t9-,12-,13-,14+,15-/m0/s1 |
| InChIKey | NEBAYFOABWUQGV-MKJLKUPLSA-N |
| XLogP | 1.31 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |