C15H11F3N2OS — CID 167493121
2-(8-amino-6H-thieno[3,4-c]azepin-4-yl)-5-(trifluoromethyl)phenol (PubChem CID 167493121) has the molecular formula C15H11F3N2OS and a molecular weight of 324.33 g/mol. Its IUPAC name is 2-(8-amino-6H-thieno[3,4-c]azepin-4-yl)-5-(trifluoromethyl)phenol.
| Compound Name | 2-(8-amino-6H-thieno[3,4-c]azepin-4-yl)-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 167493121 |
| Molecular Formula | C15H11F3N2OS |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-(8-amino-6H-thieno[3,4-c]azepin-4-yl)-5-(trifluoromethyl)phenol |
| SMILES | NC1=CCN=C(c2ccc(C(F)(F)F)cc2O)c2cscc21 |
| InChI | InChI=1S/C15H11F3N2OS/c16-15(17,18)8-1-2-9(13(21)5-8)14-11-7-22-6-10(11)12(19)3-4-20-14/h1-3,5-7,21H,4,19H2 |
| InChIKey | UVUOTGSPSHXUDU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |