C19H14N2O3S — CID 16749979
N-(furan-2-ylmethyl)-4-(3-oxo-1,2-benzothiazol-2-yl)benzamide (PubChem CID 16749979) has the molecular formula C19H14N2O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(3-oxo-1,2-benzothiazol-2-yl)benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(3-oxo-1,2-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 16749979 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(3-oxo-1,2-benzothiazol-2-yl)benzamide |
| SMILES | O=C(NCc1ccco1)c1ccc(-n2sc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C19H14N2O3S/c22-18(20-12-15-4-3-11-24-15)13-7-9-14(10-8-13)21-19(23)16-5-1-2-6-17(16)25-21/h1-11H,12H2,(H,20,22) |
| InChIKey | HRFSFFXXTXEMAV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |