C6H8FNO — CID 167506024
4-fluoro-3,6-dihydro-2H-pyridine-1-carbaldehyde (PubChem CID 167506024) has the molecular formula C6H8FNO and a molecular weight of 129.13 g/mol. Its IUPAC name is 4-fluoro-3,6-dihydro-2H-pyridine-1-carbaldehyde.
| Compound Name | 4-fluoro-3,6-dihydro-2H-pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 167506024 |
| Molecular Formula | C6H8FNO |
| Molecular Weight | 129.13 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 4-fluoro-3,6-dihydro-2H-pyridine-1-carbaldehyde |
| SMILES | O=CN1CC=C(F)CC1 |
| InChI | InChI=1S/C6H8FNO/c7-6-1-3-8(5-9)4-2-6/h1,5H,2-4H2 |
| InChIKey | NCLDHDYLHXMYSC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.13 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|