C24H40NO4P — CID 16750654
(1S,2R)-2-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(2-methylpropyl)-2-oxo-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinin-2-yl]-1-(4-methoxyphenyl)propan-1-ol (PubChem CID 16750654) has the molecular formula C24H40NO4P and a molecular weight of 437.56 g/mol. Its IUPAC name is (1S,2R)-2-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(2-methylpropyl)-2-oxo-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinin-2-yl]-1-(4-methoxyphenyl)propan-1-ol.
| Compound Name | (1S,2R)-2-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(2-methylpropyl)-2-oxo-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinin-2-yl]-1-(4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 16750654 |
| Molecular Formula | C24H40NO4P |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | (1S,2R)-2-[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-(2-methylpropyl)-2-oxo-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3,2]oxazaphosphinin-2-yl]-1-(4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc([C@H](O)[C@@H](C)[P@]2(=O)O[C@@H]3C[C@H](C)CC[C@H]3C(C)(C)N2CC(C)C)cc1 |
| InChI | InChI=1S/C24H40NO4P/c1-16(2)15-25-24(5,6)21-13-8-17(3)14-22(21)29-30(25,27)18(4)23(26)19-9-11-20(28-7)12-10-19/h9-12,16-18,21-23,26H,8,13-15H2,1-7H3/t17-,18-,21-,22-,23-,30+/m1/s1 |
| InChIKey | NJSQZOXVNCSPCY-QUWNZDMQSA-N |
| XLogP | 5.88 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|