C18H25FO2 — CID 154574107
(2R,4R,4aR,7R,8aR)-4-fluoro-2-(4-methoxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromene (PubChem CID 154574107) has the molecular formula C18H25FO2 and a molecular weight of 292.39 g/mol. Its IUPAC name is (2R,4R,4aR,7R,8aR)-4-fluoro-2-(4-methoxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromene.
| Compound Name | (2R,4R,4aR,7R,8aR)-4-fluoro-2-(4-methoxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromene |
|---|---|
| PubChem CID | 154574107 |
| Molecular Formula | C18H25FO2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (2R,4R,4aR,7R,8aR)-4-fluoro-2-(4-methoxyphenyl)-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromene |
| SMILES | COc1ccc([C@H]2C[C@@](C)(F)[C@@H]3CC[C@@H](C)C[C@H]3O2)cc1 |
| InChI | InChI=1S/C18H25FO2/c1-12-4-9-15-16(10-12)21-17(11-18(15,2)19)13-5-7-14(20-3)8-6-13/h5-8,12,15-17H,4,9-11H2,1-3H3/t12-,15-,16-,17-,18-/m1/s1 |
| InChIKey | UGPBJHZCKAKUGI-WYGQYTNYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |