C9H14F3N3O — CID 167506839
ethane;N-methyl-6-(2,2,2-trifluoroethoxy)pyridazin-3-amine (PubChem CID 167506839) has the molecular formula C9H14F3N3O and a molecular weight of 237.22 g/mol. Its IUPAC name is ethane;N-methyl-6-(2,2,2-trifluoroethoxy)pyridazin-3-amine.
| Compound Name | ethane;N-methyl-6-(2,2,2-trifluoroethoxy)pyridazin-3-amine |
|---|---|
| PubChem CID | 167506839 |
| Molecular Formula | C9H14F3N3O |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | ethane;N-methyl-6-(2,2,2-trifluoroethoxy)pyridazin-3-amine |
| SMILES | CC.CNc1ccc(OCC(F)(F)F)nn1 |
| InChI | InChI=1S/C7H8F3N3O.C2H6/c1-11-5-2-3-6(13-12-5)14-4-7(8,9)10;1-2/h2-3H,4H2,1H3,(H,11,12);1-2H3 |
| InChIKey | QPCHFKYNHVLOHS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |