C43H46O3S12 — CID 167507369
1-[4-[bis(8-acetyl-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl)methyl]-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl]ethanone (PubChem CID 167507369) has the molecular formula C43H46O3S12 and a molecular weight of 995.64 g/mol. Its IUPAC name is 1-[4-[bis(8-acetyl-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl)methyl]-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl]ethanone.
| Compound Name | 1-[4-[bis(8-acetyl-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl)methyl]-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl]ethanone |
|---|---|
| PubChem CID | 167507369 |
| Molecular Formula | C43H46O3S12 |
| Molecular Weight | 995.64 g/mol |
| Exact Mass | 994.01 |
| IUPAC Name | 1-[4-[bis(8-acetyl-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl)methyl]-2,2,6,6-tetramethyl-[1,3]dithiolo[4,5-f][1,3]benzodithiol-8-yl]ethanone |
| SMILES | CC(=O)c1c2c(c(C(c3c4c(c(C(C)=O)c5c3SC(C)(C)S5)SC(C)(C)S4)c3c4c(c(C(C)=O)c5c3SC(C)(C)S5)SC(C)(C)S4)c3c1SC(C)(C)S3)SC(C)(C)S2 |
| InChI | InChI=1S/C43H46O3S12/c1-16(44)19-26-32(53-38(4,5)47-26)23(33-27(19)48-39(6,7)54-33)22(24-34-28(49-40(8,9)55-34)20(17(2)45)29-35(24)56-41(10,11)50-29)25-36-30(51-42(12,13)57-36)21(18(3)46)31-37(25)58-43(14,15)52-31/h22H,1-15H3 |
| InChIKey | WPAXZHCWNLRONG-UHFFFAOYSA-N |
| XLogP | 17.08 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.64 |
| LogP ≤ 5 | 17.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|