C23H29ClN4O3 — CID 167507938
1-[3-chloro-4-[2-[2-(dimethylamino)ethoxy]ethyl]phenyl]-3-[(2-methyl-1-oxo-3H-isoindol-5-yl)methyl]urea (PubChem CID 167507938) has the molecular formula C23H29ClN4O3 and a molecular weight of 444.96 g/mol. Its IUPAC name is 1-[3-chloro-4-[2-[2-(dimethylamino)ethoxy]ethyl]phenyl]-3-[(2-methyl-1-oxo-3H-isoindol-5-yl)methyl]urea.
| Compound Name | 1-[3-chloro-4-[2-[2-(dimethylamino)ethoxy]ethyl]phenyl]-3-[(2-methyl-1-oxo-3H-isoindol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 167507938 |
| Molecular Formula | C23H29ClN4O3 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 1-[3-chloro-4-[2-[2-(dimethylamino)ethoxy]ethyl]phenyl]-3-[(2-methyl-1-oxo-3H-isoindol-5-yl)methyl]urea |
| SMILES | CN(C)CCOCCc1ccc(NC(=O)NCc2ccc3c(c2)CN(C)C3=O)cc1Cl |
| InChI | InChI=1S/C23H29ClN4O3/c1-27(2)9-11-31-10-8-17-5-6-19(13-21(17)24)26-23(30)25-14-16-4-7-20-18(12-16)15-28(3)22(20)29/h4-7,12-13H,8-11,14-15H2,1-3H3,(H2,25,26,30) |
| InChIKey | AXWPZXNPCPTZRX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|