C24H31ClN4O3 — CID 176736921
1-[3-chloro-4-[2-[2-(methylamino)ethoxy]ethyl]phenyl]-3-[(1-oxo-2-propan-2-yl-3H-isoindol-5-yl)methyl]urea (PubChem CID 176736921) has the molecular formula C24H31ClN4O3 and a molecular weight of 458.99 g/mol. Its IUPAC name is 1-[3-chloro-4-[2-[2-(methylamino)ethoxy]ethyl]phenyl]-3-[(1-oxo-2-propan-2-yl-3H-isoindol-5-yl)methyl]urea.
| Compound Name | 1-[3-chloro-4-[2-[2-(methylamino)ethoxy]ethyl]phenyl]-3-[(1-oxo-2-propan-2-yl-3H-isoindol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 176736921 |
| Molecular Formula | C24H31ClN4O3 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 1-[3-chloro-4-[2-[2-(methylamino)ethoxy]ethyl]phenyl]-3-[(1-oxo-2-propan-2-yl-3H-isoindol-5-yl)methyl]urea |
| SMILES | CNCCOCCc1ccc(NC(=O)NCc2ccc3c(c2)CN(C(C)C)C3=O)cc1Cl |
| InChI | InChI=1S/C24H31ClN4O3/c1-16(2)29-15-19-12-17(4-7-21(19)23(29)30)14-27-24(31)28-20-6-5-18(22(25)13-20)8-10-32-11-9-26-3/h4-7,12-13,16,26H,8-11,14-15H2,1-3H3,(H2,27,28,31) |
| InChIKey | IMFAZSINYKUIHO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|