C10H15NOS — CID 167508069
3,5-dimethyl-4H-thieno[3,4-c]pyrrol-6-one;ethane (PubChem CID 167508069) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is 3,5-dimethyl-4H-thieno[3,4-c]pyrrol-6-one;ethane.
| Compound Name | 3,5-dimethyl-4H-thieno[3,4-c]pyrrol-6-one;ethane |
|---|---|
| PubChem CID | 167508069 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 3,5-dimethyl-4H-thieno[3,4-c]pyrrol-6-one;ethane |
| SMILES | CC.Cc1scc2c1CN(C)C2=O |
| InChI | InChI=1S/C8H9NOS.C2H6/c1-5-6-3-9(2)8(10)7(6)4-11-5;1-2/h4H,3H2,1-2H3;1-2H3 |
| InChIKey | QGZYAGLVGFWJGI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |