C7H7N3O — CID 139360753
6-methyl-7H-pyrrolo[3,4-c]pyridazin-5-one (PubChem CID 139360753) has the molecular formula C7H7N3O and a molecular weight of 149.15 g/mol. Its IUPAC name is 6-methyl-7H-pyrrolo[3,4-c]pyridazin-5-one.
| Compound Name | 6-methyl-7H-pyrrolo[3,4-c]pyridazin-5-one |
|---|---|
| PubChem CID | 139360753 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 6-methyl-7H-pyrrolo[3,4-c]pyridazin-5-one |
| SMILES | CN1Cc2nnccc2C1=O |
| InChI | InChI=1S/C7H7N3O/c1-10-4-6-5(7(10)11)2-3-8-9-6/h2-3H,4H2,1H3 |
| InChIKey | ZYVPHUSQWQVNKY-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |