C11H11BrN2O2 — CID 102353279
7-bromo-2-methoxy-4-methyl-3H-1,4-benzodiazepin-5-one (PubChem CID 102353279) has the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. Its IUPAC name is 7-bromo-2-methoxy-4-methyl-3H-1,4-benzodiazepin-5-one.
| Compound Name | 7-bromo-2-methoxy-4-methyl-3H-1,4-benzodiazepin-5-one |
|---|---|
| PubChem CID | 102353279 |
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 7-bromo-2-methoxy-4-methyl-3H-1,4-benzodiazepin-5-one |
| SMILES | COC1=Nc2ccc(Br)cc2C(=O)N(C)C1 |
| InChI | InChI=1S/C11H11BrN2O2/c1-14-6-10(16-2)13-9-4-3-7(12)5-8(9)11(14)15/h3-5H,6H2,1-2H3 |
| InChIKey | GUYVYKZZENKJSD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |