C15H27NO4 — CID 167509349
tert-butyl 4-acetyl-7-amino-2,3-dimethyl-7-oxoheptanoate (PubChem CID 167509349) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is tert-butyl 4-acetyl-7-amino-2,3-dimethyl-7-oxoheptanoate.
| Compound Name | tert-butyl 4-acetyl-7-amino-2,3-dimethyl-7-oxoheptanoate |
|---|---|
| PubChem CID | 167509349 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | tert-butyl 4-acetyl-7-amino-2,3-dimethyl-7-oxoheptanoate |
| SMILES | CC(=O)C(CCC(N)=O)C(C)C(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO4/c1-9(10(2)14(19)20-15(4,5)6)12(11(3)17)7-8-13(16)18/h9-10,12H,7-8H2,1-6H3,(H2,16,18) |
| InChIKey | MCTVXPWKIIQOSA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |