C16H19ClFN3OS — CID 167513101
3-chloro-2-fluoro-6-[2-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,3-thiazol-4-yl]aniline;methane (PubChem CID 167513101) has the molecular formula C16H19ClFN3OS and a molecular weight of 355.87 g/mol. Its IUPAC name is 3-chloro-2-fluoro-6-[2-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,3-thiazol-4-yl]aniline;methane.
| Compound Name | 3-chloro-2-fluoro-6-[2-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,3-thiazol-4-yl]aniline;methane |
|---|---|
| PubChem CID | 167513101 |
| Molecular Formula | C16H19ClFN3OS |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 3-chloro-2-fluoro-6-[2-(3-oxa-8-azabicyclo[3.2.1]octan-8-yl)-1,3-thiazol-4-yl]aniline;methane |
| SMILES | C.Nc1c(-c2csc(N3C4CCC3COC4)n2)ccc(Cl)c1F |
| InChI | InChI=1S/C15H15ClFN3OS.CH4/c16-11-4-3-10(14(18)13(11)17)12-7-22-15(19-12)20-8-1-2-9(20)6-21-5-8;/h3-4,7-9H,1-2,5-6,18H2;1H4 |
| InChIKey | UDSBICDPNMNVGO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|