C14H16FNO3 — CID 167514497
N-(7-fluoro-2-formyl-2,3-dihydro-1H-inden-5-yl)-2-hydroxy-2-methylpropanamide (PubChem CID 167514497) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is N-(7-fluoro-2-formyl-2,3-dihydro-1H-inden-5-yl)-2-hydroxy-2-methylpropanamide.
| Compound Name | N-(7-fluoro-2-formyl-2,3-dihydro-1H-inden-5-yl)-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 167514497 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-(7-fluoro-2-formyl-2,3-dihydro-1H-inden-5-yl)-2-hydroxy-2-methylpropanamide |
| SMILES | CC(C)(O)C(=O)Nc1cc(F)c2c(c1)CC(C=O)C2 |
| InChI | InChI=1S/C14H16FNO3/c1-14(2,19)13(18)16-10-5-9-3-8(7-17)4-11(9)12(15)6-10/h5-8,19H,3-4H2,1-2H3,(H,16,18) |
| InChIKey | LNRPXBWYFQOGPL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|