About bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate
bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate (PubChem CID 16752258) has the molecular formula C27H16N4O8
and a molecular weight of 524.45 g/mol. Its IUPAC name is bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate |
| PubChem CID | 16752258 |
| Molecular Formula | C27H16N4O8 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)c1cc(C(=O)Oc2ccc([N+](=O)[O-])cc2)n2ccc(-c3ccncc3)cc12 |
| InChI | InChI=1S/C27H16N4O8/c32-26(38-21-5-1-19(2-6-21)30(34)35)23-16-25(27(33)39-22-7-3-20(4-8-22)31(36)37)29-14-11-18(15-24(23)29)17-9-12-28-13-10-17/h1-16H |
| InChIKey | KNEMWIJIHFEDIP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 156.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate?
The IUPAC name of bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate (CID 16752258) is bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate.
What is the SMILES notation for bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate?
The canonical SMILES for bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate is O=C(Oc1ccc([N+](=O)[O-])cc1)c1cc(C(=O)Oc2ccc([N+](=O)[O-])cc2)n2ccc(-c3ccncc3)cc12.
What is the InChIKey of bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate?
The InChIKey is KNEMWIJIHFEDIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H16N4O8/c32-26(38-21-5-1-19(2-6-21)30(34)35)23-16-25(27(33)39-22-7-3-20(4-8-22)31(36)37)29-14-11-18(15-24(23)29)17-9-12-28-13-10-17/h1-16H.
What are the key properties of bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate?
bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate has a molecular weight of 524.45 g/mol, XLogP of 5.26, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-nitrophenyl) 7-pyridin-4-ylindolizine-1,3-dicarboxylate is sourced from PubChem (CID 16752258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).