C23H22ClN5O2 — CID 16752454
2-[(4-benzyl-6-chloro-3-oxopyrazin-2-yl)amino]-N-(2-indol-1-ylethyl)acetamide (PubChem CID 16752454) has the molecular formula C23H22ClN5O2 and a molecular weight of 435.92 g/mol. Its IUPAC name is 2-[(4-benzyl-6-chloro-3-oxopyrazin-2-yl)amino]-N-(2-indol-1-ylethyl)acetamide.
| Compound Name | 2-[(4-benzyl-6-chloro-3-oxopyrazin-2-yl)amino]-N-(2-indol-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 16752454 |
| Molecular Formula | C23H22ClN5O2 |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[(4-benzyl-6-chloro-3-oxopyrazin-2-yl)amino]-N-(2-indol-1-ylethyl)acetamide |
| SMILES | O=C(CNc1nc(Cl)cn(Cc2ccccc2)c1=O)NCCn1ccc2ccccc21 |
| InChI | InChI=1S/C23H22ClN5O2/c24-20-16-29(15-17-6-2-1-3-7-17)23(31)22(27-20)26-14-21(30)25-11-13-28-12-10-18-8-4-5-9-19(18)28/h1-10,12,16H,11,13-15H2,(H,25,30)(H,26,27) |
| InChIKey | XSWBSFBVQXKLQB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |