C15H16ClN3O3 — CID 16752456
methyl 2-[[6-chloro-3-oxo-4-(2-phenylethyl)pyrazin-2-yl]amino]acetate (PubChem CID 16752456) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is methyl 2-[[6-chloro-3-oxo-4-(2-phenylethyl)pyrazin-2-yl]amino]acetate.
| Compound Name | methyl 2-[[6-chloro-3-oxo-4-(2-phenylethyl)pyrazin-2-yl]amino]acetate |
|---|---|
| PubChem CID | 16752456 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | methyl 2-[[6-chloro-3-oxo-4-(2-phenylethyl)pyrazin-2-yl]amino]acetate |
| SMILES | COC(=O)CNc1nc(Cl)cn(CCc2ccccc2)c1=O |
| InChI | InChI=1S/C15H16ClN3O3/c1-22-13(20)9-17-14-15(21)19(10-12(16)18-14)8-7-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,17,18) |
| InChIKey | SXWJXEVTZHFAFT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |