C27H26N4O3 — CID 167525301
2-[3-(2,6-dimethylphenyl)phenyl]-3-hydroxy-5-methyl-N-[3-(methylcarbamoyl)phenyl]imidazole-4-carboxamide (PubChem CID 167525301) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[3-(2,6-dimethylphenyl)phenyl]-3-hydroxy-5-methyl-N-[3-(methylcarbamoyl)phenyl]imidazole-4-carboxamide.
| Compound Name | 2-[3-(2,6-dimethylphenyl)phenyl]-3-hydroxy-5-methyl-N-[3-(methylcarbamoyl)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 167525301 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[3-(2,6-dimethylphenyl)phenyl]-3-hydroxy-5-methyl-N-[3-(methylcarbamoyl)phenyl]imidazole-4-carboxamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2c(C)nc(-c3cccc(-c4c(C)cccc4C)c3)n2O)c1 |
| InChI | InChI=1S/C27H26N4O3/c1-16-8-5-9-17(2)23(16)19-10-6-11-20(14-19)25-29-18(3)24(31(25)34)27(33)30-22-13-7-12-21(15-22)26(32)28-4/h5-15,34H,1-4H3,(H,28,32)(H,30,33) |
| InChIKey | WQWKJBSAKBSQAC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|