C13H20N6O — CID 167535467
2-[[1-amino-3-(1-methylpiperidin-4-yl)iminoprop-1-en-2-yl]amino]-1H-pyrimidin-6-one (PubChem CID 167535467) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[[1-amino-3-(1-methylpiperidin-4-yl)iminoprop-1-en-2-yl]amino]-1H-pyrimidin-6-one.
| Compound Name | 2-[[1-amino-3-(1-methylpiperidin-4-yl)iminoprop-1-en-2-yl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 167535467 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-[[1-amino-3-(1-methylpiperidin-4-yl)iminoprop-1-en-2-yl]amino]-1H-pyrimidin-6-one |
| SMILES | CN1CCC(/N=C/C(=CN)Nc2nccc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C13H20N6O/c1-19-6-3-10(4-7-19)16-9-11(8-14)17-13-15-5-2-12(20)18-13/h2,5,8-10H,3-4,6-7,14H2,1H3,(H2,15,17,18,20)/b11-8?,16-9+ |
| InChIKey | FPXRSFLRWYMCEQ-WEHMZTKHSA-N |
| XLogP | 0.15 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|