C25H18N2O — CID 16753893
2-[9-(2,4,6-trimethylphenyl)xanthen-3-ylidene]propanedinitrile (PubChem CID 16753893) has the molecular formula C25H18N2O and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[9-(2,4,6-trimethylphenyl)xanthen-3-ylidene]propanedinitrile.
| Compound Name | 2-[9-(2,4,6-trimethylphenyl)xanthen-3-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 16753893 |
| Molecular Formula | C25H18N2O |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[9-(2,4,6-trimethylphenyl)xanthen-3-ylidene]propanedinitrile |
| SMILES | Cc1cc(C)c(C2=c3ccc(=C(C#N)C#N)cc3Oc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C25H18N2O/c1-15-10-16(2)24(17(3)11-15)25-20-6-4-5-7-22(20)28-23-12-18(8-9-21(23)25)19(13-26)14-27/h4-12H,1-3H3 |
| InChIKey | QKTKBCUDEIVOPX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |