C20H32O2Si — CID 16754076
tert-butyl-[3-ethynyl-5-(2-methoxypropan-2-yl)-2-methylhepta-3,4-dien-6-yn-2-yl]oxy-dimethylsilane (PubChem CID 16754076) has the molecular formula C20H32O2Si and a molecular weight of 332.56 g/mol. Its IUPAC name is tert-butyl-[3-ethynyl-5-(2-methoxypropan-2-yl)-2-methylhepta-3,4-dien-6-yn-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[3-ethynyl-5-(2-methoxypropan-2-yl)-2-methylhepta-3,4-dien-6-yn-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 16754076 |
| Molecular Formula | C20H32O2Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | tert-butyl-[3-ethynyl-5-(2-methoxypropan-2-yl)-2-methylhepta-3,4-dien-6-yn-2-yl]oxy-dimethylsilane |
| SMILES | C#CC(=C=C(C#C)C(C)(C)O[Si](C)(C)C(C)(C)C)C(C)(C)OC |
| InChI | InChI=1S/C20H32O2Si/c1-13-16(19(6,7)21-10)15-17(14-2)20(8,9)22-23(11,12)18(3,4)5/h1-2H,3-12H3 |
| InChIKey | XBWUUVDZVUBGHM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|