C23H51NOS — CID 167547878
2,2-dimethylbutane;N-(5,5-dimethylhexyl)acetamide;3,3-dimethyl-1-methylsulfanylbutane (PubChem CID 167547878) has the molecular formula C23H51NOS and a molecular weight of 389.73 g/mol. Its IUPAC name is 2,2-dimethylbutane;N-(5,5-dimethylhexyl)acetamide;3,3-dimethyl-1-methylsulfanylbutane.
| Compound Name | 2,2-dimethylbutane;N-(5,5-dimethylhexyl)acetamide;3,3-dimethyl-1-methylsulfanylbutane |
|---|---|
| PubChem CID | 167547878 |
| Molecular Formula | C23H51NOS |
| Molecular Weight | 389.73 g/mol |
| Exact Mass | 389.37 |
| IUPAC Name | 2,2-dimethylbutane;N-(5,5-dimethylhexyl)acetamide;3,3-dimethyl-1-methylsulfanylbutane |
| SMILES | CC(=O)NCCCCC(C)(C)C.CCC(C)(C)C.CSCCC(C)(C)C |
| InChI | InChI=1S/C10H21NO.C7H16S.C6H14/c1-9(12)11-8-6-5-7-10(2,3)4;1-7(2,3)5-6-8-4;1-5-6(2,3)4/h5-8H2,1-4H3,(H,11,12);5-6H2,1-4H3;5H2,1-4H3 |
| InChIKey | CAKIMFWQFHVBIL-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.73 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|