C11H21N2NaO5 — CID 167548386
sodium 5-[2-(3-hydroxypropoxy)ethylamino]-4-(methylamino)-5-oxopentanoate (PubChem CID 167548386) has the molecular formula C11H21N2NaO5 and a molecular weight of 284.29 g/mol. Its IUPAC name is sodium 5-[2-(3-hydroxypropoxy)ethylamino]-4-(methylamino)-5-oxopentanoate.
| Compound Name | sodium 5-[2-(3-hydroxypropoxy)ethylamino]-4-(methylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 167548386 |
| Molecular Formula | C11H21N2NaO5 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | sodium 5-[2-(3-hydroxypropoxy)ethylamino]-4-(methylamino)-5-oxopentanoate |
| SMILES | CNC(CCC(=O)[O-])C(=O)NCCOCCCO.[Na+] |
| InChI | InChI=1S/C11H22N2O5.Na/c1-12-9(3-4-10(15)16)11(17)13-5-8-18-7-2-6-14;/h9,12,14H,2-8H2,1H3,(H,13,17)(H,15,16);/q;+1/p-1 |
| InChIKey | ABDUKUUHHOCNJN-UHFFFAOYSA-M |
| XLogP | -5.38 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|