C23H46N6O10S2 — CID 166464835
2-[amino-[4-(methylamino)-5-oxo-5-[2-(2-sulfanyloxyethoxy)ethylamino]pentanoyl]amino]-N'-[2-(2-hydroxyethoxy)ethyl]-N-[2-(2-sulfanyloxyethoxy)ethyl]pentanediamide (PubChem CID 166464835) has the molecular formula C23H46N6O10S2 and a molecular weight of 630.79 g/mol. Its IUPAC name is 2-[amino-[4-(methylamino)-5-oxo-5-[2-(2-sulfanyloxyethoxy)ethylamino]pentanoyl]amino]-N'-[2-(2-hydroxyethoxy)ethyl]-N-[2-(2-sulfanyloxyethoxy)ethyl]pentanediamide.
| Compound Name | 2-[amino-[4-(methylamino)-5-oxo-5-[2-(2-sulfanyloxyethoxy)ethylamino]pentanoyl]amino]-N'-[2-(2-hydroxyethoxy)ethyl]-N-[2-(2-sulfanyloxyethoxy)ethyl]pentanediamide |
|---|---|
| PubChem CID | 166464835 |
| Molecular Formula | C23H46N6O10S2 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.27 |
| IUPAC Name | 2-[amino-[4-(methylamino)-5-oxo-5-[2-(2-sulfanyloxyethoxy)ethylamino]pentanoyl]amino]-N'-[2-(2-hydroxyethoxy)ethyl]-N-[2-(2-sulfanyloxyethoxy)ethyl]pentanediamide |
| SMILES | CNC(CCC(=O)N(N)C(CCC(=O)NCCOCCO)C(=O)NCCOCCOS)C(=O)NCCOCCOS |
| InChI | InChI=1S/C23H46N6O10S2/c1-25-18(22(33)27-7-11-36-14-16-38-40)2-5-21(32)29(24)19(23(34)28-8-12-37-15-17-39-41)3-4-20(31)26-6-10-35-13-9-30/h18-19,25,30,40-41H,2-17,24H2,1H3,(H,26,31)(H,27,33)(H,28,34) |
| InChIKey | HBGNYRVQLZNLPC-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 212.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|