C31H30F12O2P2S2 — CID 16754899
10-[(2S,3R)-2-phenoxathiin-10-ium-10-ylheptan-3-yl]phenoxathiin-10-ium dihexafluorophosphate (PubChem CID 16754899) has the molecular formula C31H30F12O2P2S2 and a molecular weight of 788.64 g/mol. Its IUPAC name is 10-[(2S,3R)-2-phenoxathiin-10-ium-10-ylheptan-3-yl]phenoxathiin-10-ium dihexafluorophosphate.
| Compound Name | 10-[(2S,3R)-2-phenoxathiin-10-ium-10-ylheptan-3-yl]phenoxathiin-10-ium dihexafluorophosphate |
|---|---|
| PubChem CID | 16754899 |
| Molecular Formula | C31H30F12O2P2S2 |
| Molecular Weight | 788.64 g/mol |
| Exact Mass | 788.10 |
| IUPAC Name | 10-[(2S,3R)-2-phenoxathiin-10-ium-10-ylheptan-3-yl]phenoxathiin-10-ium dihexafluorophosphate |
| SMILES | CCCC[C@H]([C@H](C)[S+]1c2ccccc2Oc2ccccc21)[S+]1c2ccccc2Oc2ccccc21.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C31H30O2S2.2F6P/c1-3-4-17-27(35-30-20-11-7-15-25(30)33-26-16-8-12-21-31(26)35)22(2)34-28-18-9-5-13-23(28)32-24-14-6-10-19-29(24)34;2*1-7(2,3,4,5)6/h5-16,18-22,27H,3-4,17H2,1-2H3;;/q+2;2*-1/t22-,27+;;/m0../s1 |
| InChIKey | NHCIOZDVJQBODP-PYJDJSNZSA-N |
| XLogP | 15.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.64 |
| LogP ≤ 5 | 15.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|