C18H17F6OPS — CID 16753633
10-[(2Z)-hexa-2,5-dien-2-yl]phenoxathiin-10-ium hexafluorophosphate (PubChem CID 16753633) has the molecular formula C18H17F6OPS and a molecular weight of 426.36 g/mol. Its IUPAC name is 10-[(2Z)-hexa-2,5-dien-2-yl]phenoxathiin-10-ium hexafluorophosphate.
| Compound Name | 10-[(2Z)-hexa-2,5-dien-2-yl]phenoxathiin-10-ium hexafluorophosphate |
|---|---|
| PubChem CID | 16753633 |
| Molecular Formula | C18H17F6OPS |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 10-[(2Z)-hexa-2,5-dien-2-yl]phenoxathiin-10-ium hexafluorophosphate |
| SMILES | C=CC/C=C(/C)[S+]1c2ccccc2Oc2ccccc21.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C18H17OS.F6P/c1-3-4-9-14(2)20-17-12-7-5-10-15(17)19-16-11-6-8-13-18(16)20;1-7(2,3,4,5)6/h3,5-13H,1,4H2,2H3;/q+1;-1/b14-9-; |
| InChIKey | DQDFEMXVIUBPRM-WQRRWHLMSA-N |
| XLogP | 8.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|