C18H17OS+ — CID 16753634
10-[(2Z)-hexa-2,5-dien-2-yl]phenoxathiin-10-ium (PubChem CID 16753634) has the molecular formula C18H17OS+ and a molecular weight of 281.40 g/mol. Its IUPAC name is 10-[(2Z)-hexa-2,5-dien-2-yl]phenoxathiin-10-ium.
| Compound Name | 10-[(2Z)-hexa-2,5-dien-2-yl]phenoxathiin-10-ium |
|---|---|
| PubChem CID | 16753634 |
| Molecular Formula | C18H17OS+ |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 10-[(2Z)-hexa-2,5-dien-2-yl]phenoxathiin-10-ium |
| SMILES | C=CC/C=C(/C)[S+]1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C18H17OS/c1-3-4-9-14(2)20-17-12-7-5-10-15(17)19-16-11-6-8-13-18(16)20/h3,5-13H,1,4H2,2H3/q+1/b14-9- |
| InChIKey | FAMMGTCXWJNNGO-ZROIWOOFSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|