C17H17F6OPS — CID 16753820
10-[(Z)-pent-2-en-2-yl]phenoxathiin-10-ium hexafluorophosphate (PubChem CID 16753820) has the molecular formula C17H17F6OPS and a molecular weight of 414.35 g/mol. Its IUPAC name is 10-[(Z)-pent-2-en-2-yl]phenoxathiin-10-ium hexafluorophosphate.
| Compound Name | 10-[(Z)-pent-2-en-2-yl]phenoxathiin-10-ium hexafluorophosphate |
|---|---|
| PubChem CID | 16753820 |
| Molecular Formula | C17H17F6OPS |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 10-[(Z)-pent-2-en-2-yl]phenoxathiin-10-ium hexafluorophosphate |
| SMILES | CC/C=C(/C)[S+]1c2ccccc2Oc2ccccc21.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C17H17OS.F6P/c1-3-8-13(2)19-16-11-6-4-9-14(16)18-15-10-5-7-12-17(15)19;1-7(2,3,4,5)6/h4-12H,3H2,1-2H3;/q+1;-1/b13-8-; |
| InChIKey | KPGUTAOCBNZGKE-MGAWDJABSA-N |
| XLogP | 8.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|