C30H26F12O2P2S2 — CID 16754901
10-(1-phenoxathiin-10-ium-10-ylhex-5-en-2-yl)phenoxathiin-10-ium dihexafluorophosphate (PubChem CID 16754901) has the molecular formula C30H26F12O2P2S2 and a molecular weight of 772.59 g/mol. Its IUPAC name is 10-(1-phenoxathiin-10-ium-10-ylhex-5-en-2-yl)phenoxathiin-10-ium dihexafluorophosphate.
| Compound Name | 10-(1-phenoxathiin-10-ium-10-ylhex-5-en-2-yl)phenoxathiin-10-ium dihexafluorophosphate |
|---|---|
| PubChem CID | 16754901 |
| Molecular Formula | C30H26F12O2P2S2 |
| Molecular Weight | 772.59 g/mol |
| Exact Mass | 772.07 |
| IUPAC Name | 10-(1-phenoxathiin-10-ium-10-ylhex-5-en-2-yl)phenoxathiin-10-ium dihexafluorophosphate |
| SMILES | C=CCCC(C[S+]1c2ccccc2Oc2ccccc21)[S+]1c2ccccc2Oc2ccccc21.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C30H26O2S2.2F6P/c1-2-3-12-22(34-29-19-10-6-15-25(29)32-26-16-7-11-20-30(26)34)21-33-27-17-8-4-13-23(27)31-24-14-5-9-18-28(24)33;2*1-7(2,3,4,5)6/h2,4-11,13-20,22H,1,3,12,21H2;;/q+2;2*-1 |
| InChIKey | IFDYTGAPNJTONR-UHFFFAOYSA-N |
| XLogP | 14.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.59 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|