About 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol
2-[(3Z)-3-methylhepta-3,6-dienyl]phenol (PubChem CID 135084324) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol.
Molecular Properties
| Compound Name | 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol |
| PubChem CID | 135084324 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol |
| SMILES | C=CC/C=C(/C)CCc1ccccc1O |
| InChI | InChI=1S/C14H18O/c1-3-4-7-12(2)10-11-13-8-5-6-9-14(13)15/h3,5-9,15H,1,4,10-11H2,2H3/b12-7- |
| InChIKey | DXLJANKLBLHONE-GHXNOFRVSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol?
The IUPAC name of 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol (CID 135084324) is 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol.
What is the SMILES notation for 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol?
The canonical SMILES for 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol is C=CC/C=C(/C)CCc1ccccc1O.
What is the InChIKey of 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol?
The InChIKey is DXLJANKLBLHONE-GHXNOFRVSA-N. The full InChI is InChI=1S/C14H18O/c1-3-4-7-12(2)10-11-13-8-5-6-9-14(13)15/h3,5-9,15H,1,4,10-11H2,2H3/b12-7-.
What are the key properties of 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol?
2-[(3Z)-3-methylhepta-3,6-dienyl]phenol has a molecular weight of 202.30 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol is sourced from PubChem (CID 135084324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).