C14H18O — CID 135084324
2-[(3Z)-3-methylhepta-3,6-dienyl]phenol (PubChem CID 135084324) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol.
| Compound Name | 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol |
|---|---|
| PubChem CID | 135084324 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-[(3Z)-3-methylhepta-3,6-dienyl]phenol |
| SMILES | C=CC/C=C(/C)CCc1ccccc1O |
| InChI | InChI=1S/C14H18O/c1-3-4-7-12(2)10-11-13-8-5-6-9-14(13)15/h3,5-9,15H,1,4,10-11H2,2H3/b12-7- |
| InChIKey | DXLJANKLBLHONE-GHXNOFRVSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|