C21H41FO5Si — CID 167551465
[(2S,4S,5S)-6-ethyl-2-fluoro-4,5-dimethyloxan-3-yl]oxy-[[(3S,4S,6S)-6-methoxy-3,4,5-trimethyloxan-2-yl]methoxy]-dimethylsilane (PubChem CID 167551465) has the molecular formula C21H41FO5Si and a molecular weight of 420.64 g/mol. Its IUPAC name is [(2S,4S,5S)-6-ethyl-2-fluoro-4,5-dimethyloxan-3-yl]oxy-[[(3S,4S,6S)-6-methoxy-3,4,5-trimethyloxan-2-yl]methoxy]-dimethylsilane.
| Compound Name | [(2S,4S,5S)-6-ethyl-2-fluoro-4,5-dimethyloxan-3-yl]oxy-[[(3S,4S,6S)-6-methoxy-3,4,5-trimethyloxan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 167551465 |
| Molecular Formula | C21H41FO5Si |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | [(2S,4S,5S)-6-ethyl-2-fluoro-4,5-dimethyloxan-3-yl]oxy-[[(3S,4S,6S)-6-methoxy-3,4,5-trimethyloxan-2-yl]methoxy]-dimethylsilane |
| SMILES | CCC1O[C@@H](F)C(O[Si](C)(C)OCC2O[C@H](OC)C(C)[C@@H](C)[C@@H]2C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C21H41FO5Si/c1-10-17-14(4)15(5)19(20(22)25-17)27-28(8,9)24-11-18-13(3)12(2)16(6)21(23-7)26-18/h12-21H,10-11H2,1-9H3/t12-,13-,14-,15-,16?,17?,18?,19?,20+,21-/m0/s1 |
| InChIKey | PIQFBBWQMJXBRS-GGWMJJRASA-N |
| XLogP | 4.75 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|