C17H24OS2 — CID 167560649
2-(3-butylsulfanyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-cyclopropylethanone (PubChem CID 167560649) has the molecular formula C17H24OS2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 2-(3-butylsulfanyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-cyclopropylethanone.
| Compound Name | 2-(3-butylsulfanyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-cyclopropylethanone |
|---|---|
| PubChem CID | 167560649 |
| Molecular Formula | C17H24OS2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-(3-butylsulfanyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1-cyclopropylethanone |
| SMILES | CCCCSc1c(CC(=O)C2CC2)sc2c1CCCC2 |
| InChI | InChI=1S/C17H24OS2/c1-2-3-10-19-17-13-6-4-5-7-15(13)20-16(17)11-14(18)12-8-9-12/h12H,2-11H2,1H3 |
| InChIKey | DPNFKZRPSWHCJI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|