C27H38F3N3O3S — CID 167561548
8-oxo-12-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[3-propan-2-yl-5-(trifluoromethyl)phenyl]dodecanamide (PubChem CID 167561548) has the molecular formula C27H38F3N3O3S and a molecular weight of 541.68 g/mol. Its IUPAC name is 8-oxo-12-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[3-propan-2-yl-5-(trifluoromethyl)phenyl]dodecanamide.
| Compound Name | 8-oxo-12-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[3-propan-2-yl-5-(trifluoromethyl)phenyl]dodecanamide |
|---|---|
| PubChem CID | 167561548 |
| Molecular Formula | C27H38F3N3O3S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 8-oxo-12-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[3-propan-2-yl-5-(trifluoromethyl)phenyl]dodecanamide |
| SMILES | CC(C)c1cc(NC(=O)CCCCCCC(=O)CCCCC2SCC3NC(=O)NC32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H38F3N3O3S/c1-17(2)18-13-19(27(28,29)30)15-20(14-18)31-24(35)12-6-4-3-5-9-21(34)10-7-8-11-23-25-22(16-37-23)32-26(36)33-25/h13-15,17,22-23,25H,3-12,16H2,1-2H3,(H,31,35)(H2,32,33,36) |
| InChIKey | DSJOMPMMJDGRNC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|