C23H32F3N5O3S — CID 146568995
N-[3-amino-5-(trifluoromethyl)phenyl]-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanamide (PubChem CID 146568995) has the molecular formula C23H32F3N5O3S and a molecular weight of 515.60 g/mol. Its IUPAC name is N-[3-amino-5-(trifluoromethyl)phenyl]-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanamide.
| Compound Name | N-[3-amino-5-(trifluoromethyl)phenyl]-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanamide |
|---|---|
| PubChem CID | 146568995 |
| Molecular Formula | C23H32F3N5O3S |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | N-[3-amino-5-(trifluoromethyl)phenyl]-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanamide |
| SMILES | Nc1cc(NC(=O)CCCCCNC(=O)CCCCC2SCC3NC(=O)NC32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H32F3N5O3S/c24-23(25,26)14-10-15(27)12-16(11-14)29-20(33)8-2-1-5-9-28-19(32)7-4-3-6-18-21-17(13-35-18)30-22(34)31-21/h10-12,17-18,21H,1-9,13,27H2,(H,28,32)(H,29,33)(H2,30,31,34) |
| InChIKey | IJMQMWHEYGEAIN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|