C23H20N2O6S — CID 167564757
5-[(2-cyclopropylphenyl)sulfonylmethyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167564757) has the molecular formula C23H20N2O6S and a molecular weight of 452.49 g/mol. Its IUPAC name is 5-[(2-cyclopropylphenyl)sulfonylmethyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[(2-cyclopropylphenyl)sulfonylmethyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167564757 |
| Molecular Formula | C23H20N2O6S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 5-[(2-cyclopropylphenyl)sulfonylmethyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CS(=O)(=O)c4ccccc4C4CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H20N2O6S/c26-20-10-9-18(21(27)24-20)25-22(28)16-8-5-13(11-17(16)23(25)29)12-32(30,31)19-4-2-1-3-15(19)14-6-7-14/h1-5,8,11,14,18H,6-7,9-10,12H2,(H,24,26,27) |
| InChIKey | ADXCXSWFSYLVIY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|