C19H36O6Si — CID 16756916
methyl (2R,3aS,4S,6R,7R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-ethoxy-7-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-carboxylate (PubChem CID 16756916) has the molecular formula C19H36O6Si and a molecular weight of 388.58 g/mol. Its IUPAC name is methyl (2R,3aS,4S,6R,7R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-ethoxy-7-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-carboxylate.
| Compound Name | methyl (2R,3aS,4S,6R,7R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-ethoxy-7-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 16756916 |
| Molecular Formula | C19H36O6Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | methyl (2R,3aS,4S,6R,7R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-ethoxy-7-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-carboxylate |
| SMILES | CCO[C@H]1C[C@@H]2[C@H](O1)[C@@H](OC)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2C(=O)OC |
| InChI | InChI=1S/C19H36O6Si/c1-9-23-15-11-12-13(18(20)22-6)10-14(17(21-5)16(12)24-15)25-26(7,8)19(2,3)4/h12-17H,9-11H2,1-8H3/t12-,13-,14+,15+,16-,17-/m0/s1 |
| InChIKey | GMJPRYCFCGOCLU-HAEOWDPNSA-N |
| XLogP | 3.35 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|