C15H8Cl2OS — CID 167575439
1,4-dichloro-3-methyl-10-sulfanylideneanthracen-9-one (PubChem CID 167575439) has the molecular formula C15H8Cl2OS and a molecular weight of 307.20 g/mol. Its IUPAC name is 1,4-dichloro-3-methyl-10-sulfanylideneanthracen-9-one.
| Compound Name | 1,4-dichloro-3-methyl-10-sulfanylideneanthracen-9-one |
|---|---|
| PubChem CID | 167575439 |
| Molecular Formula | C15H8Cl2OS |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 1,4-dichloro-3-methyl-10-sulfanylideneanthracen-9-one |
| SMILES | Cc1cc(Cl)c2c(c1Cl)C(=S)c1ccccc1C2=O |
| InChI | InChI=1S/C15H8Cl2OS/c1-7-6-10(16)11-12(13(7)17)15(19)9-5-3-2-4-8(9)14(11)18/h2-6H,1H3 |
| InChIKey | RPCHMSLFICRWGE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|