C47H63N9O5 — CID 167577573
bis(5-tert-butyl-N-(6-methylidene-2-oxopiperidin-3-yl)pyridine-2-carboxamide);3-[(6-tert-butyl-3-pyridinyl)amino]-6-methylidenepiperidin-2-one (PubChem CID 167577573) has the molecular formula C47H63N9O5 and a molecular weight of 834.08 g/mol. Its IUPAC name is bis(5-tert-butyl-N-(6-methylidene-2-oxopiperidin-3-yl)pyridine-2-carboxamide);3-[(6-tert-butyl-3-pyridinyl)amino]-6-methylidenepiperidin-2-one.
| Compound Name | bis(5-tert-butyl-N-(6-methylidene-2-oxopiperidin-3-yl)pyridine-2-carboxamide);3-[(6-tert-butyl-3-pyridinyl)amino]-6-methylidenepiperidin-2-one |
|---|---|
| PubChem CID | 167577573 |
| Molecular Formula | C47H63N9O5 |
| Molecular Weight | 834.08 g/mol |
| Exact Mass | 833.50 |
| IUPAC Name | bis(5-tert-butyl-N-(6-methylidene-2-oxopiperidin-3-yl)pyridine-2-carboxamide);3-[(6-tert-butyl-3-pyridinyl)amino]-6-methylidenepiperidin-2-one |
| SMILES | C=C1CCC(NC(=O)c2ccc(C(C)(C)C)cn2)C(=O)N1.C=C1CCC(NC(=O)c2ccc(C(C)(C)C)cn2)C(=O)N1.C=C1CCC(Nc2ccc(C(C)(C)C)nc2)C(=O)N1 |
| InChI | InChI=1S/2C16H21N3O2.C15H21N3O/c2*1-10-5-7-13(15(21)18-10)19-14(20)12-8-6-11(9-17-12)16(2,3)4;1-10-5-7-12(14(19)17-10)18-11-6-8-13(16-9-11)15(2,3)4/h2*6,8-9,13H,1,5,7H2,2-4H3,(H,18,21)(H,19,20);6,8-9,12,18H,1,5,7H2,2-4H3,(H,17,19) |
| InChIKey | GSYLFANQXWMNEK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 196.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.08 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |